angie5210 angie5210
  • 04-01-2024
  • Chemistry
contestada

Draw the condensed structure of 3-ethyl-1,1,4-triiodo-4-methylhexane.

A) CH3CHI2CH(CH3)CH2CH2CH2CH3
B) CH3CHI2CHI(CH3)CH2CH2CH2CH3
C) CH3CH2CH(CH3)CHI2CH2CH2CH2I
D) CH3CH2CHI(CH3)CHI2CH2CH2CH3

Respuesta :

Otras preguntas

Use breaking apart to find the product in multiplication 7x3
Is this a sentence fragment or complete sentence? I have always been interested in these special creatures.
What times what will give m the answer 64
Together, tom and max have 72 football cards. Tom has 2 more than 4 times as many cards as Max has. How many football cards does tom have?
how do 7.6 be written in word form
Juliette is driving her car when she sees a cat run across the road. If she is able to stop the car over a distance of 0.025km in 2.5 s, what is her average acc
a symbol for caledonium
what would result if chromosomes did not replicate during interphase
Write an equation. Then solve the problem.Arturo built 3 sandcastles with 6 towers each. Paco built 5 sandcastles with 4 towers each. Who built more towers? How
The thunderbolt bobsled team is training for Olympic Gold. During practice they start a run with a speed of 0.57 m/s, they complete the 1360 m run in 89.49 seco